21-12-2016
Spanish

contestada

what do "clubes de futbol' refer to in the spanish-speaking world

Respuesta :

BeautifulAfflictions BeautifulAfflictions

17-07-2017

That would refer to soccer teams.

Answer Link

Otras preguntas

Callies family spends an average of $70 per month electric at that rate what can that family expect to pay electric for 1 year

4 + 4 (1 + 5m) = -132

What is a farmer with a small farm called

PLS HELP ASAP DUE SOON IN 10 - 20 MINUTES PLS HELPPPRead the excerpt from The Riddle of the Rosetta Stone.Before the Rosetta Stone was discovered in 1799, no on

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

Homework: Compound Probability (With Replacement) You have a jar or marbles in front of you with the following colors, 7 Red, 12 Blue, 6 Green, and 9 White. Wha

n this assignment, you will explore how to find the number of different species of fish in a pond by looking at a random sample of the fish. Which phrase best d

What type of government did Charles X's monarchy most resemble? A. Republic B. Democracy C. Dictatorship D. Anarchy

There's a snake in your boot HarrietA. There's a snake in your boot, Harriet?B. There's a snake in your boot, Harriet!C. There's a snake in your boot Harriet.

If a city has a population of 500,000 and the population has been rising 3% each year, what will the population be in 13 years?