24matthewjett 24matthewjett

23-08-2021
Mathematics

contestada

don't know this help me

dont know this help me class=

Relax

Respuesta :

ma5007482 ma5007482

23-08-2021

Answer:

Option D is correct.

Step-by-step explanation:

Subtraction property is not in the table.

Subtraction property is that "subtract some value on the both sides of equality".

Answer Link

Otras preguntas

under capitalism the legal system protect___and businesses are run for profit

Describe American foreign policy today

Write a linear equation with a slope of -9/5 and passes through the point (10,-2). Answers + explanations please!

Cause and effect of delegate involving the nature of the colonist's relationship with great Britain before the french and Indian war. The events that changed th

Solve for u. u-3.62 = 7.4

What parts make up any story or piece of literature? * A) Literary genres B) Literary elements

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

Choose the correct answer! ( sorry if it's hard :( ) 1. A dot (.) represents a _______. Options: a. line b. point c. line segment d. stop 2. A _______ has two e

Here are several function rules. Calculate the output for each rule when you use -6 as the input.

2. zinc (III) chlorate →